4-(Dimethylamino)benzophenone
Modify Date: 2025-08-20 21:56:02
4-(Dimethylamino)benzophenone structure
|
Common Name | 4-(Dimethylamino)benzophenone | ||
|---|---|---|---|---|
| CAS Number | 530-44-9 | Molecular Weight | 225.28600 | |
| Density | 1.096g/cm3 | Boiling Point | 250 °C / 15mmHg | |
| Molecular Formula | C15H15NO | Melting Point | 88-90 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 141.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(Dimethylamino)benzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 250 °C / 15mmHg |
| Melting Point | 88-90 °C(lit.) |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.28600 |
| Flash Point | 141.2ºC |
| Exact Mass | 225.11500 |
| PSA | 20.31000 |
| LogP | 2.98360 |
| Index of Refraction | 1.6 |
| InChIKey | BEUGBYXJXMVRFO-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)c2ccccc2)cc1 |
| Water Solubility | insoluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922399090 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| [4-(dimethylamino)phenyl]-phenylmethanone |
| 4-(DiMethylaMino)benzophenone |
| EINECS 208-478-4 |
| MFCD00008311 |