BENZOIC ACID, 2-(1-ACETYL-2-OXOPROPYL)- structure
|
Common Name | BENZOIC ACID, 2-(1-ACETYL-2-OXOPROPYL)- | ||
|---|---|---|---|---|
| CAS Number | 52962-26-2 | Molecular Weight | 220.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 2-(2,4-dioxopentan-3-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O4 |
|---|---|
| Molecular Weight | 220.22100 |
| Exact Mass | 220.07400 |
| PSA | 71.44000 |
| LogP | 1.64640 |
| InChIKey | CKPUMDIQROCRDB-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(C)=O)c1ccccc1C(=O)O |
| HS Code | 2918300090 |
|---|
|
~%
BENZOIC ACID, 2... CAS#:52962-26-2 |
| Literature: Citterio, Attilio; Ferrario, Francesco Journal of Chemical Research, Miniprint, 1983 , # 12 p. 2656 - 2668 |
|
~%
BENZOIC ACID, 2... CAS#:52962-26-2 |
| Literature: Hurtley Journal of the Chemical Society, 1929 , p. 1872 |
|
~%
BENZOIC ACID, 2... CAS#:52962-26-2 |
| Literature: Hurtley Journal of the Chemical Society, 1929 , p. 1872 |
|
~%
BENZOIC ACID, 2... CAS#:52962-26-2 |
| Literature: Hurtley Journal of the Chemical Society, 1929 , p. 1872 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-(o-carboxyphenyl)pentane-2,4-dione |
| 2-<1-Acetyl-2-oxo-propyl>-benzoesaeure |
| 2-Diacetylmethyl-benzoesaeure |
| 3-(2-Carboxy-phenyl)-pentandion-(2.4) |
| 3-(2-Carboxyphenyl)pentane-2,4-dione |
| 2-(1-acetyl-2-oxo-propyl)-benzoic acid |
| ms-(2-Carboxy-phenyl)-acetylaceton |