(Chloromethyl)(triphenyl)phosphonium chloride structure
|
Common Name | (Chloromethyl)(triphenyl)phosphonium chloride | ||
|---|---|---|---|---|
| CAS Number | 5293-84-5 | Molecular Weight | 347.218 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17Cl2P | Melting Point | 262-264 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (chloromethyl)triphenylphosphonium chloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 262-264 °C(lit.) |
|---|---|
| Molecular Formula | C19H17Cl2P |
| Molecular Weight | 347.218 |
| Exact Mass | 346.044495 |
| PSA | 13.59000 |
| LogP | 1.18080 |
| InChIKey | SXYFAZGVNNYGJQ-UHFFFAOYSA-M |
| SMILES | ClC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | TA1882000 |
| HS Code | 2931900090 |
|
~%
(Chloromethyl)(... CAS#:5293-84-5 |
| Literature: Organic Letters, , vol. 6, # 6 p. 929 - 931 |
|
~%
(Chloromethyl)(... CAS#:5293-84-5 |
| Literature: Chemische Berichte, , vol. 94, p. 1373 - 1383 |
|
~%
(Chloromethyl)(... CAS#:5293-84-5 |
| Literature: Journal of Organic Chemistry, , vol. 31, p. 305 - 308 |
|
~%
(Chloromethyl)(... CAS#:5293-84-5 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 659, p. 49 - 63 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD00011867 |
| EINECS 226-139-9 |
| Phosphonium, (chloromethyl)triphenyl-, chloride |
| (Chloromethyl)(triphenyl)phosphonium chloride |
| Phosphonium, (chloromethyl)triphenyl-, chloride (1:1) |
| chloromethyl(triphenyl)phosphanium,chloride |
| (Chloromethyl)triphenylphosphonium chloride |