Ethyl benzylidenemalonate structure
|
Common Name | Ethyl benzylidenemalonate | ||
|---|---|---|---|---|
| CAS Number | 5292-53-5 | Molecular Weight | 248.274 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 335.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C14H16O4 | Melting Point | 28-31°C | |
| MSDS | N/A | Flash Point | 149.6±20.7 °C | |
| Name | diethyl benzylidenemalonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 335.5±0.0 °C at 760 mmHg |
| Melting Point | 28-31°C |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.274 |
| Flash Point | 149.6±20.7 °C |
| Exact Mass | 248.104858 |
| PSA | 52.60000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | VUWPIBNKJSEYIN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=Cc1ccccc1)C(=O)OCC |
| Supplemental HS | Contact with acids liberates toxic gas. |
|---|---|
| Personal Protective Equipment | Eyeshields;Gloves |
| Safety Phrases | S23-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | WE2150000 |
| HS Code | 2917399090 |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Integration of heterogeneous catalysts into complex synthetic routes: sequential vs. one-pot reactions in a (Knoevenagel+ Mukaiyama-Michael+ hydrogenation+ transesterification) sequence. Fraile JM, et al.
Catal. Sci. Tech. 3(2) , 436-443, (2013)
|
|
|
Reactions of a-aminoazoles with diethyl benzylidenemalonate. Lipson VV, et al.
Russ. J. Org. Chem. 43(2) , 249-255, (2007)
|
| Benzylidenemalonic Acid Diethyl Ester |
| Propanedioic acid, (phenylmethylene)-, diethyl ester |
| EINECS 226-137-8 |
| Diethyl 2-benzylidenemalonate |
| diethyl 2-benzylidenepropanedioate |
| Benzalmalonic Acid Diethyl Ester |
| Malonic acid, benzylidene-, diethyl ester |
| Propanedioic acid, 2-(phenylmethylene)-, diethyl ester |
| Diethyl Benzalmalonate |
| Diethyl benzylidenemalonate |
| Ethyl benzylidenemalonate |
| MFCD00009149 |