N-(6-methoxyquinolin-8-yl)-N-propan-2-yl-pentane-1,4-diamine structure
|
Common Name | N-(6-methoxyquinolin-8-yl)-N-propan-2-yl-pentane-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 529-73-7 | Molecular Weight | 301.42600 | |
| Density | 1.056g/cm3 | Boiling Point | 467.4ºC at 760 mmHg | |
| Molecular Formula | C18H27N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.5ºC | |
| Name | Isopentaquine |
|---|
| Density | 1.056g/cm3 |
|---|---|
| Boiling Point | 467.4ºC at 760 mmHg |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.42600 |
| Flash Point | 236.5ºC |
| Exact Mass | 301.21500 |
| PSA | 46.18000 |
| LogP | 4.28590 |
| Index of Refraction | 1.575 |
| InChIKey | FXVNYPZBTGPKQO-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(C)CCCNC(C)C)c2ncccc2c1 |
| HS Code | 2933499090 |
|---|
|
~%
N-(6-methoxyqui... CAS#:529-73-7 |
| Literature: Elderfield; Rubin Journal of the American Chemical Society, 1953 , vol. 75, p. 2963,2969 |
|
~%
N-(6-methoxyqui... CAS#:529-73-7 |
| Literature: Elderfield; Rubin Journal of the American Chemical Society, 1953 , vol. 75, p. 2963,2969 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |