2,2',3,4',5,5',6-PCB
Modify Date: 2025-08-25 17:43:54
2,2',3,4',5,5',6-PCB structure
|
Common Name | 2,2',3,4',5,5',6-PCB | ||
|---|---|---|---|---|
| CAS Number | 52663-68-0 | Molecular Weight | 395.323 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 408.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H3Cl7 | Melting Point | 149°C | |
| MSDS | N/A | Flash Point | 198.9±24.7 °C | |
| Symbol |
GHS08, GHS09 |
Signal Word | Warning | |
| Name | 2,2',3,4',5,5',6-Heptachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.2±40.0 °C at 760 mmHg |
| Melting Point | 149°C |
| Molecular Formula | C12H3Cl7 |
| Molecular Weight | 395.323 |
| Flash Point | 198.9±24.7 °C |
| Exact Mass | 391.805450 |
| LogP | 7.12 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | UDMZPLROONOSEF-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(-c2c(Cl)c(Cl)cc(Cl)c2Cl)cc1Cl |
| Storage condition | room temp |
| Symbol |
GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H373-H410 |
| Precautionary Statements | P273-P391-P501 |
| Hazard Codes | N |
| Risk Phrases | 33-50/53 |
| Safety Phrases | 60-61 |
| RIDADR | UN 3432 9 / PGII |
| HS Code | 2903999090 |
|
~%
2,2',3,4',5,5',6-PCB CAS#:52663-68-0 |
| Literature: Bolgar; et al. Chemosphere, 1995 , vol. 31, # 2 p. 2687 - 2705 |
|
~%
2,2',3,4',5,5',6-PCB CAS#:52663-68-0 |
| Literature: Bolgar; et al. Chemosphere, 1995 , vol. 31, # 2 p. 2687 - 2705 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1'-Biphenyl, 2,2',3,4',5,5',6-heptachloro- |
| 1,2,4,5-tetrachloro-3-(2,4,5-trichlorophenyl)benzene |
| 2,2',3,4',5,5',6-Heptachlorobiphenyl |
| 2,2',3,4',5,5',6-PCB |