5-NITRO-2-(PHENYLTHIO)BENZALDEHYDE structure
|
Common Name | 5-NITRO-2-(PHENYLTHIO)BENZALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 52548-32-0 | Molecular Weight | 259.28000 | |
| Density | 1.36g/cm3 | Boiling Point | 413.2ºC at 760 mmHg | |
| Molecular Formula | C13H9NO3S | Melting Point | 106-107ºC | |
| MSDS | N/A | Flash Point | 203.7ºC | |
| Name | 5-nitro-2-phenylsulfanylbenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 413.2ºC at 760 mmHg |
| Melting Point | 106-107ºC |
| Molecular Formula | C13H9NO3S |
| Molecular Weight | 259.28000 |
| Flash Point | 203.7ºC |
| Exact Mass | 259.03000 |
| PSA | 88.19000 |
| LogP | 4.08170 |
| Index of Refraction | 1.666 |
| InChIKey | XWIWOASJHKVEKI-UHFFFAOYSA-N |
| SMILES | O=Cc1cc([N+](=O)[O-])ccc1Sc1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2930909090 |
|
~%
5-NITRO-2-(PHEN... CAS#:52548-32-0 |
| Literature: Beers, Scott A.; Malloy, Elizabeth A.; Wu, Wei; Wachter, Michael P.; Gunnia, Uma; Cavender, Druie; Harris, Crafford; Davis, Janet; Brosius, Ruth; Pellegrino-Gensey, J. Lee; Siekierka, John Bioorganic and Medicinal Chemistry, 1997 , vol. 5, # 12 p. 2203 - 2211 |
|
~%
5-NITRO-2-(PHEN... CAS#:52548-32-0 |
| Literature: Hoffmann-La Roche Inc. Patent: US4006144 A1, 1977 ; |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Nitro-2-phenylmercapto-benzaldehyd |
| 5-Nitro-2-(phenylthio)benzaldehyde |
| 5-nitro-2-phenylsulfanyl-benzaldehyde |
| 3-nitro-6-(phenylthio)-benzaldehyde |