5-(aminosulphonyl)-2-methoxybenzoyl chloride
Modify Date: 2025-08-25 20:25:09
5-(aminosulphonyl)-2-methoxybenzoyl chloride structure
|
Common Name | 5-(aminosulphonyl)-2-methoxybenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 52542-44-6 | Molecular Weight | 249.67100 | |
| Density | 1.479g/cm3 | Boiling Point | 455.4ºC at 760 mmHg | |
| Molecular Formula | C8H8ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.2ºC | |
| Name | 2-methoxy-5-sulfamoylbenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.479g/cm3 |
|---|---|
| Boiling Point | 455.4ºC at 760 mmHg |
| Molecular Formula | C8H8ClNO4S |
| Molecular Weight | 249.67100 |
| Flash Point | 229.2ºC |
| Exact Mass | 248.98600 |
| PSA | 94.84000 |
| LogP | 2.50270 |
| Index of Refraction | 1.566 |
| InChIKey | XFZMCFJADJFEBB-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)Cl |
| HS Code | 2935009090 |
|---|
|
~%
5-(aminosulphon... CAS#:52542-44-6 |
| Literature: Brennan; Imondi; Westmoreland; Williamson Journal of Pharmaceutical Sciences, 1982 , vol. 71, # 11 p. 1199 - 1203 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| EINECS 257-996-7 |
| 5-(Aminosulphonyl)-2-methoxybenzoyl chloride |