WAY-324242-A
Modify Date: 2025-09-28 13:05:39
WAY-324242-A structure
|
Common Name | WAY-324242-A | ||
|---|---|---|---|---|
| CAS Number | 524058-63-7 | Molecular Weight | 395.33 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 505.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H27BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.5±30.1 °C | |
Use of WAY-324242-AGPCR Ligand |
| Name | WAY-324242-A |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 505.5±50.0 °C at 760 mmHg |
| Molecular Formula | C19H27BrN2O2 |
| Molecular Weight | 395.33 |
| Flash Point | 259.5±30.1 °C |
| Exact Mass | 394.125580 |
| LogP | 3.80 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | POCCWDXEMQOTQF-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)cc1CN1CCCC(C(=O)N2CCCCC2)C1 |
| Methanone, [1-[(5-bromo-2-methoxyphenyl)methyl]-3-piperidinyl]-1-piperidinyl- |
| [1-(5-Bromo-2-methoxybenzyl)-3-piperidinyl](1-piperidinyl)methanone |
| [1-(5-Bromo-2-methoxy-benzyl)-piperidin-3-yl]-piperidin-1-yl-methanone |