2,3-DIHYDRO-1H-INDENE-5-SULFONYL CHLORIDE structure
|
Common Name | 2,3-DIHYDRO-1H-INDENE-5-SULFONYL CHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 52205-85-3 | Molecular Weight | 216.68500 | |
| Density | 1.396g/cm3 | Boiling Point | 322.1ºC at 760 mmHg | |
| Molecular Formula | C9H9ClO2S | Melting Point | 45 - 50 ℃ | |
| MSDS | Chinese USA | Flash Point | 148.6ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | Indane-5-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 322.1ºC at 760 mmHg |
| Melting Point | 45 - 50 ℃ |
| Molecular Formula | C9H9ClO2S |
| Molecular Weight | 216.68500 |
| Flash Point | 148.6ºC |
| Exact Mass | 216.00100 |
| PSA | 42.52000 |
| LogP | 3.18360 |
| Index of Refraction | 1.588 |
| InChIKey | SWLIXMXSCZYVTQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc2c(c1)CCC2 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Hazard Codes | C |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGIII |
| HS Code | 2904909090 |
|
~%
2,3-DIHYDRO-1H-... CAS#:52205-85-3 |
| Literature: Bock, Hans; Rittmeyer, Peter Phosphorus, Sulfur and Silicon and the Related Elements, 1992 , vol. 68, # 1-4 p. 261 - 292 |
|
~%
2,3-DIHYDRO-1H-... CAS#:52205-85-3 |
| Literature: Eli Lilly and Company, Eli Lilly and Company Patent: WO2004/48329 A1, 2004 ; Location in patent: Page 13 ; |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,3-Dihydro-1H-indene-5-sulfonyl chloride |
| 2,3-dihydro-1H-indene-5-sulfonyl chloride |
| Indan-5-sulfonyl chloride |