acetic acid; 6-[[(3-bromophenyl)amino]methyl]-5-chloro-quinazoline-2,4-diamine structure
|
Common Name | acetic acid; 6-[[(3-bromophenyl)amino]methyl]-5-chloro-quinazoline-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 52128-42-4 | Molecular Weight | 438.70600 | |
| Density | N/A | Boiling Point | 639.9ºC at 760 mmHg | |
| Molecular Formula | C17H17BrClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.8ºC | |
| Name | acetic acid,6-[(3-bromoanilino)methyl]-5-chloroquinazoline-2,4-diamine |
|---|
| Boiling Point | 639.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H17BrClN5O2 |
| Molecular Weight | 438.70600 |
| Flash Point | 340.8ºC |
| Exact Mass | 437.02500 |
| PSA | 127.15000 |
| LogP | 5.14850 |
| InChIKey | JJWMGLUQJLOMGV-UHFFFAOYSA-N |
| SMILES | CC(=O)O.Nc1nc(N)c2c(Cl)c(CNc3cccc(Br)c3)ccc2n1 |
| HS Code | 2933990090 |
|---|
|
~15%
acetic acid; 6-... CAS#:52128-42-4 |
| Literature: Elslager, Edward F.; Johnson, Judith L.; Werbel, Leslie M. Journal of Medicinal Chemistry, 1983 , vol. 26, # 12 p. 1753 - 1760 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |