2-Bromo-4-nitropyridine 1-oxide structure
|
Common Name | 2-Bromo-4-nitropyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 52092-43-0 | Molecular Weight | 218.993 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 430.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C5H3BrN2O3 | Melting Point | 143-146°C | |
| MSDS | N/A | Flash Point | 214.0±23.2 °C | |
| Name | 2-Bromo-4-nitropyridine N-Oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 430.2±25.0 °C at 760 mmHg |
| Melting Point | 143-146°C |
| Molecular Formula | C5H3BrN2O3 |
| Molecular Weight | 218.993 |
| Flash Point | 214.0±23.2 °C |
| Exact Mass | 217.932693 |
| PSA | 71.28000 |
| LogP | 0.02 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | IRBDHXCXCSFNEQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc[n+]([O-])c(Br)c1 |
| Risk Phrases | R23/24/25;R36/37/38 |
|---|---|
| Safety Phrases | S22-S26-S36/37/39 |
| RIDADR | 2811.0 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2933399090 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 2-bromo-4-nitro-, 1-oxide |
| 2-Bromo-4-nitropyridine 1-oxide |
| MFCD00160743 |
| 2-Bromo-4-nitropyridine N-oxide |