1,3,5-Triazine,hexahydro-1,3,5-tris(phenylsulfonyl)- structure
|
Common Name | 1,3,5-Triazine,hexahydro-1,3,5-tris(phenylsulfonyl)- | ||
|---|---|---|---|---|
| CAS Number | 52082-67-4 | Molecular Weight | 507.60300 | |
| Density | 1.486g/cm3 | Boiling Point | 712.2ºC at 760mmHg | |
| Molecular Formula | C21H21N3O6S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 384.5ºC | |
| Name | 1,3,5-tris(benzenesulfonyl)-1,3,5-triazinane |
|---|
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 712.2ºC at 760mmHg |
| Molecular Formula | C21H21N3O6S3 |
| Molecular Weight | 507.60300 |
| Flash Point | 384.5ºC |
| Exact Mass | 507.05900 |
| PSA | 137.28000 |
| LogP | 5.00130 |
| Index of Refraction | 1.66 |
| InChIKey | ZMEDTJVWRLFNFS-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)N1CN(S(=O)(=O)c2ccccc2)CN(S(=O)(=O)c2ccccc2)C1 |
| HS Code | 2933699090 |
|---|
|
~%
1,3,5-Triazine,... CAS#:52082-67-4 |
| Literature: Hug Bulletin de la Societe Chimique de France, 1934 , vol. <5>1, p. 990,1002 |
|
~%
1,3,5-Triazine,... CAS#:52082-67-4 |
| Literature: Magnus-Lewy Chemische Berichte, 1893 , vol. 26, p. 2149 |
|
~%
Detail
|
| Literature: Magnus-Lewy Chemische Berichte, 1893 , vol. 26, p. 2149 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |