1H,1H,2H,2H-PERFLUOROOCTYLTRIETHOXYSILANE structure
|
Common Name | 1H,1H,2H,2H-PERFLUOROOCTYLTRIETHOXYSILANE | ||
|---|---|---|---|---|
| CAS Number | 51851-37-7 | Molecular Weight | 510.364 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 272.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H19F13O3Si | Melting Point | <-38ºC | |
| MSDS | Chinese USA | Flash Point | 118.5±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1h,1h,2h,2h-perfluorooctyltriethoxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.4±40.0 °C at 760 mmHg |
| Melting Point | <-38ºC |
| Molecular Formula | C14H19F13O3Si |
| Molecular Weight | 510.364 |
| Flash Point | 118.5±27.3 °C |
| Exact Mass | 510.089600 |
| PSA | 27.69000 |
| LogP | 7.10 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.349 |
| InChIKey | AVYKQOAMZCAHRG-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H413 |
| Precautionary Statements | P280-P305 + P351 + P338-P337 + P313 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37-S60 |
| RIDADR | 3265 |
| Packaging Group | III |
|
Mitigation of Corrosion on Magnesium Alloy by Predesigned Surface Corrosion.
Sci. Rep. 5 , 17399, (2015) Rapid corrosion of magnesium alloys is undesirable in structural and biomedical applications and a general way to control corrosion is to form a surface barrier layer isolating the bulk materials from... |
|
|
Topography-Guided Proliferation: Distinct Surface Microtopography Increases Proliferation of Chondrocytes In Vitro.
Tissue Eng. Part A 21 , 2757-65, (2015) Chondrocyte-based cartilage repair techniques require control of articular chondrocyte expansion ex vivo. Articular chondrocytes have limited availability, and prolonged culturing to obtain a cell num... |
|
|
Lung damage in mice after inhalation of nanofilm spray products: the role of perfluorination and free hydroxyl groups.
Toxicol. Sci. 116 , 216-24, (2010) Exposures to two commercial nanofilm spray products (NFPs), a floor sealant (NFP 1) and a coating product for tiles (NFP 2), were investigated for airway irritation, airway inflammation, and lung dama... |
| 1H,1H,2H,2H-Perfluorooctyltriethoxysilane |
| MFCD00042333 |
| EINECS 257-473-3 |
| Perfluororooctyltriethoxysilane |
| Triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| triethoxytridecafluorooctylsilane |
| DYNASYLAN F8262 |
| DYNASYLAN F8261 |
| Silane, triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)- |
| Triethoxy-1H,1H,2H,2H-perfluoro-n-octylsilane |
| DYNASYLAN F8261,min |
| DYNASYLANF |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyltriethoxysilan |
| Triethoxy-1H,1H,2H,2H-tridecafluoro-n-octylsilane |
| Perfluorooctyltriethoxysilane |
| DYNASYLANFmin |
| F-8261 |
| Tridecafluorotriethoxysilane |
| 1H,1H,2H,2H-Tridecafluoro-n-octyltriethoxysilane |