JNJ-10311795 structure
|
Common Name | JNJ-10311795 | ||
|---|---|---|---|---|
| CAS Number | 518062-14-1 | Molecular Weight | 670.68900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H35N2O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JNJ-10311795JNJ-10311795 (RWJ-355871), a potent dual inhibitor of neutrophil cathepsin G (Ki = 38 nM) and mast cell chymase (Ki = 2.3 nM), exhibits noteworthy antiinflammatory activity[1]. |
| Name | [2-[3-[methyl-[1-(naphthalene-2-carbonyl)piperidin-4-yl]carbamoyl]naphthalen-2-yl]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | JNJ-10311795 (RWJ-355871), a potent dual inhibitor of neutrophil cathepsin G (Ki = 38 nM) and mast cell chymase (Ki = 2.3 nM), exhibits noteworthy antiinflammatory activity[1]. |
|---|---|
| Related Catalog | |
| Target |
Ki: 38 nM (cathepsin G), 2.3 nM (chymase)[1]. |
| References |
| Molecular Formula | C40H35N2O6P |
|---|---|
| Molecular Weight | 670.68900 |
| Exact Mass | 670.22300 |
| PSA | 125.03000 |
| LogP | 7.56260 |
| InChIKey | XUJQPDQURBZEGJ-UHFFFAOYSA-N |
| SMILES | CN(C(=O)c1cc2ccccc2cc1C(=O)C(c1cccc2ccccc12)P(=O)(O)O)C1CCN(C(=O)c2ccc3ccccc3c2)CC1 |
| Phosphonic acid,(2-(3-((methyl(1-(2-naphthalenylcarbonyl)-4-piperidinyl)amino)carbonyl)-2-naphthalenyl)-1-(1-naphthalenyl)-2-oxoethyl) |
| UNII-W3IL23KVI4 |
| Phosphonic acid,P-(2-(3-((methyl(1-(2-naphthalenylcarbonyl)-4-piperidinyl)amino)carbonyl)-2-naphthalenyl)-1-(1-naphthalenyl)-2-oxoethyl) |