3-(Perfluorobutyryl)-(+)-camphor structure
|
Common Name | 3-(Perfluorobutyryl)-(+)-camphor | ||
|---|---|---|---|---|
| CAS Number | 51800-99-8 | Molecular Weight | 348.25700 | |
| Density | 1.218 g/mL at 25 °C(lit.) | Boiling Point | 60-70 °C0.2 mm Hg(lit.) | |
| Molecular Formula | C14H15F7O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 201 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-heptafluorobutyryl-(+)-camphor |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 60-70 °C0.2 mm Hg(lit.) |
| Molecular Formula | C14H15F7O2 |
| Molecular Weight | 348.25700 |
| Flash Point | 201 °F |
| Exact Mass | 348.09600 |
| PSA | 34.14000 |
| LogP | 4.02980 |
| Appearance of Characters | light yellow |
| Index of Refraction | n20/D 1.421(lit.) |
| InChIKey | PEWOESYEGLBLNR-XGLFCGLISA-N |
| SMILES | CC12CCC(C(C(=O)C(F)(F)C(F)(F)C(F)(F)F)C1=O)C2(C)C |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2914700090 |
|
~%
3-(Perfluorobut... CAS#:51800-99-8 |
| Literature: Goering,H.L. et al. Journal of the American Chemical Society, 1974 , vol. 96, p. 1493 - 1501 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-heptafluorobutyryl-(-)-camphor |
| (+)-3-heptafluorobutanoylcampher |
| (+)-3-(Heptafluorobutyryl)-(+)-camphor (3-(Perfluorobutyryl)-D-camphor |
| 3-(Perfluorobutyryl)-D-camphor |
| EINECS 257-430-9 |
| 3-trifluoroacetyl-(+)-camphor |
| MFCD00064154 |
| 3-(2,2,3,3,4,4,4-Heptafluorobutanoyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| (1R,4R)-5-(Heptafluorobutyryl)bornane-6-one |
| (+)-3-(Heptafluorobutyryl)-(+)-camphor,3-(Perfluorobutyryl)-D-camphor |
| (1R,4R)-3-(Heptafluorobutyryl)bornane-2-one |
| (1R,4R)-3-(Heptafluorobutyryl)-1,7,7-trimethylbicyclo[2.2.1]heptane-2-one |
| 3-HEPTAFLUOROBUTYRYL-D-CAMPHOR |