Benzoic acid, 2- (4,5,6-trihydroxy-3-oxo-3H-xanthen-9-yl)- structure
|
Common Name | Benzoic acid, 2- (4,5,6-trihydroxy-3-oxo-3H-xanthen-9-yl)- | ||
|---|---|---|---|---|
| CAS Number | 518-41-2 | Molecular Weight | 364.30500 | |
| Density | 1.73g/cm3 | Boiling Point | 712.1ºC at 760 mmHg | |
| Molecular Formula | C20H12O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.8ºC | |
| Name | 2-(4,5,6-Trihydroxy-3-oxo-3H-xanthen-9-yl)-benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 712.1ºC at 760 mmHg |
| Molecular Formula | C20H12O7 |
| Molecular Weight | 364.30500 |
| Flash Point | 262.8ºC |
| Exact Mass | 364.05800 |
| PSA | 128.20000 |
| LogP | 3.37980 |
| Index of Refraction | 1.816 |
| InChIKey | QCGYJIWVJKJCCH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1-c1c2ccc(=O)c(O)c-2oc2c(O)c(O)ccc12 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4,5,6-TRIHYDROXY-3-OXO-3H-XANTHEN-9-YL)-BENZOIC ACID |
| 2-(3,4,5-trihydroxy-6-oxoxanthen-9-yl)benzoic acid |