5-(2-adamantylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione
Modify Date: 2025-08-22 04:30:01
5-(2-adamantylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione structure
|
Common Name | 5-(2-adamantylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 51757-47-2 | Molecular Weight | 276.32800 | |
| Density | 1.242g/cm3 | Boiling Point | 495.1ºC at 760 mmHg | |
| Molecular Formula | C16H20O4 | Melting Point | 207-208ºC(lit.) | |
| MSDS | USA | Flash Point | 259.8ºC | |
| Name | 5-(2-adamantylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 495.1ºC at 760 mmHg |
| Melting Point | 207-208ºC(lit.) |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.32800 |
| Flash Point | 259.8ºC |
| Exact Mass | 276.13600 |
| PSA | 52.60000 |
| LogP | 2.57520 |
| Index of Refraction | 1.552 |
| InChIKey | SIYYOHROEIZBBC-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(=O)C(=C2C3CC4CC(C3)CC2C4)C(=O)O1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
|
~89%
5-(2-adamantyli... CAS#:51757-47-2 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY Patent: WO2008/24892 A2, 2008 ; Location in patent: Page/Page column 69-70 ; WO 2008/024892 A2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2-dimethyl-5-tricyclo[3.3.1.13,7]dec-2-ylidene-1,3-dioxane-4,6-dione |
| MFCD00167792 |