boc-gly-met-oh structure
|
Common Name | boc-gly-met-oh | ||
|---|---|---|---|---|
| CAS Number | 51529-39-6 | Molecular Weight | 306.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | boc-gly-met-oh |
|---|
| Molecular Formula | C12H22N2O5S |
|---|---|
| Molecular Weight | 306.37800 |
| Exact Mass | 306.12500 |
| PSA | 130.03000 |
| LogP | 1.61540 |
| InChIKey | WGPKWTXLWUBUSI-QMMMGPOBSA-N |
| SMILES | CSCCC(NC(=O)CNC(=O)OC(C)(C)C)C(=O)O |
| HS Code | 2930909090 |
|---|
|
~%
boc-gly-met-oh CAS#:51529-39-6 |
| Literature: Lyons, Anthony Q.; Pettit, Leslie D. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1984 , p. 2305 - 2308 |
|
~%
boc-gly-met-oh CAS#:51529-39-6 |
| Literature: Lyons, Anthony Q.; Pettit, Leslie D. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1984 , p. 2305 - 2308 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |