S-(4-methylphenyl) 2-[2-(4-methylphenyl)sulfanylcarbonylphenyl]benzenecarbothioate structure
|
Common Name | S-(4-methylphenyl) 2-[2-(4-methylphenyl)sulfanylcarbonylphenyl]benzenecarbothioate | ||
|---|---|---|---|---|
| CAS Number | 51439-35-1 | Molecular Weight | 454.60300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H22O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(4-methylphenyl) 2-[2-(4-methylphenyl)sulfanylcarbonylphenyl]benzenecarbothioate |
|---|
| Molecular Formula | C28H22O2S2 |
|---|---|
| Molecular Weight | 454.60300 |
| Exact Mass | 454.10600 |
| PSA | 84.74000 |
| LogP | 7.83540 |
| InChIKey | QJLPRGDWNFLFRE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SC(=O)c2ccccc2-c2ccccc2C(=O)Sc2ccc(C)cc2)cc1 |
|
~94%
S-(4-methylphen... CAS#:51439-35-1 |
| Literature: Steliou, Kosta; Salama, Paul; Yu, Xiaoping Journal of the American Chemical Society, 1992 , vol. 114, # 4 p. 1456 - 1462 |
|
~%
S-(4-methylphen... CAS#:51439-35-1 |
| Literature: Martens,J. et al. Justus Liebigs Annalen der Chemie, 1975 , p. 62 - 74 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |