3-methyl-1,1-diphenyl-2,5-dihydrosilole structure
|
Common Name | 3-methyl-1,1-diphenyl-2,5-dihydrosilole | ||
|---|---|---|---|---|
| CAS Number | 51343-48-7 | Molecular Weight | 250.41000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-1,1-diphenyl-2,5-dihydrosilole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18Si |
|---|---|
| Molecular Weight | 250.41000 |
| Exact Mass | 250.11800 |
| LogP | 3.20950 |
| InChIKey | NSIPEFHHLTVFKK-UHFFFAOYSA-N |
| SMILES | CC1=CC[Si](c2ccccc2)(c2ccccc2)C1 |
|
~84%
3-methyl-1,1-di... CAS#:51343-48-7 |
| Literature: Ohmura, Toshimichi; Masuda, Kohei; Takase, Ichiro; Suginome, Michinori Journal of the American Chemical Society, 2009 , vol. 131, # 46 p. 16624 - 16625 |
|
~78%
3-methyl-1,1-di... CAS#:51343-48-7 |
| Literature: Stevens, Andrew C.; Pagenkopf, Brian L. Organic Letters, 2010 , vol. 12, # 16 p. 3658 - 3661 |
|
~%
3-methyl-1,1-di... CAS#:51343-48-7 |
| Literature: Takaki, Ken; Komeyama, Kimihiro; Takehira, Katsuomi Tetrahedron, 2003 , vol. 59, # 52 p. 10381 - 10395 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1-diphenyl-3-methyl-3-silacyclopentene |
| Silacyclopent-3-ene,3-methyl-1,1-diphenyl |
| 2,5-dihydro-3-methyl-1,1-diphenylsilole |
| 3-Methyl-1,1-diphenyl-2,5-dihydro-1H-silole |
| 1,1-Diphenyl-3-methylsilacyclopent-3-ene |
| 1,1-Diphenyl-3-methyl-1-sila-3-cyclopenten |
| 3-methyl-1,1-diphenyl-silacyclopent-3-ene |
| 1,1-Diphenyl-3-methyl-1-silacyclopent-3-ene |