ethyl bis(2,2,2-trichloroethyl) phosphate structure
|
Common Name | ethyl bis(2,2,2-trichloroethyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 51287-49-1 | Molecular Weight | 388.82500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H9Cl6O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl bis(2,2,2-trichloroethyl) phosphate |
|---|
| Molecular Formula | C6H9Cl6O4P |
|---|---|
| Molecular Weight | 388.82500 |
| Exact Mass | 385.83700 |
| PSA | 54.57000 |
| LogP | 4.90460 |
| InChIKey | UUYAPKGPSOHNDJ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
|
~%
ethyl bis(2,2,2... CAS#:51287-49-1 |
| Literature: Ogilvie,K.K. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 1277 - 1278 |