tris(2,2,2-trichloroethyl) phosphate structure
|
Common Name | tris(2,2,2-trichloroethyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 20405-30-5 | Molecular Weight | 492.16000 | |
| Density | 1.8g/cm3 | Boiling Point | 395.4ºC at 760mmHg | |
| Molecular Formula | C6H6Cl9O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.4ºC | |
| Name | tris(2,2,2-trichloroethyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8g/cm3 |
|---|---|
| Boiling Point | 395.4ºC at 760mmHg |
| Molecular Formula | C6H6Cl9O4P |
| Molecular Weight | 492.16000 |
| Flash Point | 297.4ºC |
| Exact Mass | 487.72000 |
| PSA | 54.57000 |
| LogP | 6.25490 |
| Vapour Pressure | 4.22E-06mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | ODPLNIWRFSCKKO-UHFFFAOYSA-N |
| SMILES | O=P(OCC(Cl)(Cl)Cl)(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| EINECS 243-793-0 |
| Ethanol,2,2,2-trichloro-,1,1',1''-phosphate |