5-[(2,4-dichlorophenyl)methylidene]thiazolidine-2,4-dione structure
|
Common Name | 5-[(2,4-dichlorophenyl)methylidene]thiazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 51244-45-2 | Molecular Weight | 274.12300 | |
| Density | 1.622g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H5Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Z)-5-(2,4-dichlorobenzylidene)thiazolidine-2,4-dione |
|---|
| Density | 1.622g/cm3 |
|---|---|
| Molecular Formula | C10H5Cl2NO2S |
| Molecular Weight | 274.12300 |
| Exact Mass | 272.94200 |
| PSA | 71.47000 |
| LogP | 3.64610 |
| Index of Refraction | 1.71 |
| InChIKey | XUOVOGTZQNQWFV-FPYGCLRLSA-N |
| SMILES | O=C1NC(=O)C(=Cc2ccc(Cl)cc2Cl)S1 |
| Storage condition | -20℃ |
|
~90%
5-[(2,4-dichlor... CAS#:51244-45-2 |
| Literature: Shah, Sakshi; Singh, Baldev Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 17 p. 5388 - 5391 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |