nicotine N(1')-oxide structure
|
Common Name | nicotine N(1')-oxide | ||
|---|---|---|---|---|
| CAS Number | 51095-86-4 | Molecular Weight | 178.231 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O | Melting Point | 182-183℃ | |
| MSDS | N/A | Flash Point | N/A | |
Use of nicotine N(1')-oxide(1′S,2′S)-Nicotine-1'-oxide is an alkaloid N-oxide from the leaves, stems and roots of Nicotiana tabacum[1]. |
| Name | nicotine-1'-N-oxide |
|---|---|
| Synonym | More Synonyms |
| Description | (1′S,2′S)-Nicotine-1'-oxide is an alkaloid N-oxide from the leaves, stems and roots of Nicotiana tabacum[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 182-183℃ |
|---|---|
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.231 |
| Exact Mass | 178.110611 |
| PSA | 42.32000 |
| LogP | -0.76 |
| InChIKey | RWFBQHICRCUQJJ-JQWIXIFHSA-N |
| SMILES | C[N+]1([O-])CCCC1c1cccnc1 |
| Storage condition | 2-8℃ |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 3-(1-Methyl-1-oxido-2-pyrrolidinyl)pyridine |
| nicotine N(1')-oxide |
| (1'S,2'S)-Nicotine 1'-Oxide |
| (1'S,2'S)-Nicotine-1'-oxide |
| 1'S,2'S)-NICOTINE 1'-OXIDE |
| Pyridine, 3-(1-methyl-1-oxido-2-pyrrolidinyl)- |