2,2,7,7-Tetramethyl-3,6-dithia-2,7-disilaoctane structure
|
Common Name | 2,2,7,7-Tetramethyl-3,6-dithia-2,7-disilaoctane | ||
|---|---|---|---|---|
| CAS Number | 51048-29-4 | Molecular Weight | 238.561 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 245.8±23.0 °C at 760 mmHg | |
| Molecular Formula | C8H22S2Si2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 102.5±22.6 °C | |
| Name | S,S'-Bis(trimethylsilyl)-1,2-ethanedithiol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 245.8±23.0 °C at 760 mmHg |
| Molecular Formula | C8H22S2Si2 |
| Molecular Weight | 238.561 |
| Flash Point | 102.5±22.6 °C |
| Exact Mass | 238.070145 |
| PSA | 50.60000 |
| LogP | 4.49 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.470 |
| InChIKey | CBRFJNLREFDKBD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)SCCS[Si](C)(C)C |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
D.A. Evans et al.
J. Am. Chem. Soc. 99 , 5009, (1977)
|
|
|
S.P. Tanis, L.A. Dixon
Tetrahedron Lett. 28 , 2495, (1987)
|
| 3,6-Dithia-2,7-disilaoctane, 2,2,7,7-tetramethyl- |
| 1,2-Bis(trimethylsilylthio)ethane |
| Ethylenedithiobis(triMethylsilane) |
| trimethyl(2-trimethylsilylsulfanylethylsulfanyl)silane |
| EINECS 256-935-1 |
| 2,2,7,7-Tetramethyl-3,6-dithia-2,7-disilaoctane |
| 1,2-Ethanedithiobis(trimethylsilane) |
| MFCD00042832 |