Spiro[furan-2(5H),9-[9H]xanthen]-5-one, 3,4-dihydro-3,6-dihydroxy- structure
|
Common Name | Spiro[furan-2(5H),9-[9H]xanthen]-5-one, 3,4-dihydro-3,6-dihydroxy- | ||
|---|---|---|---|---|
| CAS Number | 510-51-0 | Molecular Weight | 284.26300 | |
| Density | 1.56g/cm3 | Boiling Point | 599.5ºC at 760 mmHg | |
| Molecular Formula | C16H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.6ºC | |
| Name | 3',6'-dihydroxyspiro[oxolane-5,9'-xanthene]-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 599.5ºC at 760 mmHg |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.26300 |
| Flash Point | 232.6ºC |
| Exact Mass | 284.06800 |
| PSA | 75.99000 |
| LogP | 2.78410 |
| Index of Refraction | 1.732 |
| InChIKey | NVCAQTQOTOXMQY-UHFFFAOYSA-N |
| SMILES | O=C1CCC2(O1)c1ccc(O)cc1Oc1cc(O)ccc12 |
| HS Code | 2932999099 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Succinylfluorescin |
| succinylfluorescein,lactonic form |
| Resorcinsuccinein |