N-butyl-5-nitro-pyrimidine-2,4-diamine structure
|
Common Name | N-butyl-5-nitro-pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 5096-85-5 | Molecular Weight | 211.22100 | |
| Density | 1.328g/cm3 | Boiling Point | 422.4ºC at 760 mmHg | |
| Molecular Formula | C8H13N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.2ºC | |
| Name | N2-butyl-5-nitro-pyrimidine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 422.4ºC at 760 mmHg |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22100 |
| Flash Point | 209.2ºC |
| Exact Mass | 211.10700 |
| PSA | 109.65000 |
| LogP | 2.35640 |
| Index of Refraction | 1.632 |
| InChIKey | MRPQAOULWHZPTA-UHFFFAOYSA-N |
| SMILES | CCCCNc1ncc([N+](=O)[O-])c(N)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitro-4-amino-2-butylamino-pyrimidin |