6-chloro-5-nitro-pyrimidine-2,4-diamine structure
|
Common Name | 6-chloro-5-nitro-pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 6036-64-2 | Molecular Weight | 189.56000 | |
| Density | 1.818g/cm3 | Boiling Point | 537.6ºC at 760 mmHg | |
| Molecular Formula | C4H4ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.9ºC | |
| Name | 6-chloro-5-nitropyrimidine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.818g/cm3 |
|---|---|
| Boiling Point | 537.6ºC at 760 mmHg |
| Molecular Formula | C4H4ClN5O2 |
| Molecular Weight | 189.56000 |
| Flash Point | 278.9ºC |
| Exact Mass | 189.00500 |
| PSA | 123.64000 |
| LogP | 1.88820 |
| Index of Refraction | 1.747 |
| InChIKey | PQRPNYCCQLFXNK-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c([N+](=O)[O-])c(Cl)n1 |
| Storage condition | 2-8°C |
|
~41%
6-chloro-5-nitr... CAS#:6036-64-2 |
| Literature: Marchetti, Francesco; Cano, Celine; Curtin, Nicola J.; Golding, Bernard T.; Griffin, Roger J.; Haggerty, Karen; Newell, David R.; Parsons, Rachel J.; Payne, Sara L.; Wang, Lan Z.; Hardcastle, Ian R. Organic and Biomolecular Chemistry, 2010 , vol. 8, # 10 p. 2397 - 2407 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-chloro-5-nitropyrimidine-2,6-diamine |
| 2,4-diamino-5-nitro-6-chloropyrimidine |
| 6-chloro-5-nitro-pyrimidine-2,4-diamine |