(S)-BENZYL 2-(PYRROLIDINE-1-CARBONYL)PYRROLIDINE-1-CARBOXYLATE structure
|
Common Name | (S)-BENZYL 2-(PYRROLIDINE-1-CARBONYL)PYRROLIDINE-1-CARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 50888-84-1 | Molecular Weight | 302.36800 | |
| Density | 1.233g/cm3 | Boiling Point | 485.614ºC at 760 mmHg | |
| Molecular Formula | C17H22N2O3 | Melting Point | 132-135ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 247.491ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | benzyl (2S)-2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 485.614ºC at 760 mmHg |
| Melting Point | 132-135ºC(lit.) |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.36800 |
| Flash Point | 247.491ºC |
| Exact Mass | 302.16300 |
| PSA | 49.85000 |
| LogP | 2.28580 |
| Index of Refraction | 1.584 |
| InChIKey | VJDNUCLKCQKXMM-HNNXBMFYSA-N |
| SMILES | O=C(C1CCCN1C(=O)OCc1ccccc1)N1CCCC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~82%
(S)-BENZYL 2-(P... CAS#:50888-84-1 |
| Literature: Zhu, Ming-Kui; Cun, Lin-Feng; Mi, Ai-Qiao; Jiang, Yao-Zhong; Gong, Liu-Zhu Tetrahedron Asymmetry, 2006 , vol. 17, # 4 p. 491 - 493 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Z-Pro-pyrrolidine |
| MFCD00799477 |