2,2,3,3,3-pentafluoropropyl-1,1,2,2-tetrafluoroethyl ether structure
|
Common Name | 2,2,3,3,3-pentafluoropropyl-1,1,2,2-tetrafluoroethyl ether | ||
|---|---|---|---|---|
| CAS Number | 50807-74-4 | Molecular Weight | 250.06200 | |
| Density | 1.567 | Boiling Point | 68 °C | |
| Molecular Formula | C5H3F9O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 3.3ºC | |
| Name | 2,2,3,3,3-Pentafluoropropyl 1,1,2,2-tetrafluoro-ethyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.567 |
|---|---|
| Boiling Point | 68 °C |
| Molecular Formula | C5H3F9O |
| Molecular Weight | 250.06200 |
| Flash Point | 3.3ºC |
| Exact Mass | 250.00400 |
| PSA | 9.23000 |
| LogP | 3.05850 |
| Index of Refraction | 1.283 |
| InChIKey | RPSFZSRVLPIAMN-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)OCC(F)(F)C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S23-S24/25 |
| HS Code | 2909199090 |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,1,1,2,2-pentafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane |
| MFCD00236117 |