(3-phenoxyphenyl)methyl acetate
Modify Date: 2025-09-02 15:47:51
(3-phenoxyphenyl)methyl acetate structure
|
Common Name | (3-phenoxyphenyl)methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 50789-44-1 | Molecular Weight | 242.27000 | |
| Density | 1.138g/cm3 | Boiling Point | 338.8ºC at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.2ºC | |
| Name | (3-phenoxyphenyl)methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 338.8ºC at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 140.2ºC |
| Exact Mass | 242.09400 |
| PSA | 35.53000 |
| LogP | 3.54200 |
| Index of Refraction | 1.558 |
| InChIKey | XPHQNMNGUGOWGU-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1cccc(Oc2ccccc2)c1 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| Benzenemethanol,3-phenoxy-,acetate |
| 3-phenoxybenzyl acetate |
| EINECS 256-765-8 |
| 2-phenoxybenzyl acetate |
| m-Phenoxybenzyl acetate |
| m-Phenoxybenzylacetat |