pth-isoleucine
Modify Date: 2024-01-14 13:10:26
pth-isoleucine structure
|
Common Name | pth-isoleucine | ||
|---|---|---|---|---|
| CAS Number | 5066-94-4 | Molecular Weight | 248.34400 | |
| Density | 1.21g/cm3 | Boiling Point | 337.8ºC at 760 mmHg | |
| Molecular Formula | C13H16N2OS | Melting Point | 182ºC | |
| MSDS | Chinese USA | Flash Point | 158.1ºC | |
| Name | Phenylthiohydantoin-isoleucine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 337.8ºC at 760 mmHg |
| Melting Point | 182ºC |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.34400 |
| Flash Point | 158.1ºC |
| Exact Mass | 248.09800 |
| PSA | 64.43000 |
| LogP | 2.71620 |
| Index of Refraction | 24 ° (C=1, EtOH) |
| InChIKey | NMRFWXLNHGJLIU-UHFFFAOYSA-N |
| SMILES | CCC(C)C1NC(=S)N(c2ccccc2)C1=O |
| Storage condition | −20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00057213 |
| PTH-ISOLEUCINE |
| 5-butan-2-yl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| 5-sec-Butyl-3-phenyl-2-thiohydantoin (contains PTH-alloisoleucine) |
| PTH-isoleucine (contains PTH-alloisoleucine) |
| EINECS 225-771-2 |