Rotundifuran structure
|
Common Name | Rotundifuran | ||
|---|---|---|---|---|
| CAS Number | 50656-65-0 | Molecular Weight | 362.50300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RotundifuranRotundifuran, a labdane type diterpene, is isolated from Vitex rotundifolia. Rotundifuran can inhibit the cell cycle progression and induce apoptosis in human myeloid leukaemia cells[1][2]. |
| Name | [(1R,3R,4R,4aS,8aS)-4-[2-(furan-3-yl)ethyl]-4-hydroxy-3,4a,8,8-tetramethyl-2,3,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Rotundifuran, a labdane type diterpene, is isolated from Vitex rotundifolia. Rotundifuran can inhibit the cell cycle progression and induce apoptosis in human myeloid leukaemia cells[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H34O4 |
|---|---|
| Molecular Weight | 362.50300 |
| Exact Mass | 362.24600 |
| PSA | 59.67000 |
| LogP | 4.74740 |
| InChIKey | QKHCQFQIJKXMOE-UGFIEOPBSA-N |
| SMILES | CC(=O)OC1CC(C)C(O)(CCc2ccoc2)C2(C)CCCC(C)(C)C12 |
| Storage condition | 2-8℃ |
| Rotundifuran |
| UNII-T2UY9AYG4O |