4-Pentylphenyl 4-methylbenzoate
Modify Date: 2025-08-27 20:26:01
4-Pentylphenyl 4-methylbenzoate structure
|
Common Name | 4-Pentylphenyl 4-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 50649-59-7 | Molecular Weight | 282.37700 | |
| Density | 1.04 g/cm3 | Boiling Point | 409.3ºC at 760 mmHg | |
| Molecular Formula | C19H22O2 | Melting Point | 34-38ºC | |
| MSDS | USA | Flash Point | 110ºC | |
| Symbol |
GHS09 |
Signal Word | Warning | |
| Name | (4-pentylphenyl) 4-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04 g/cm3 |
|---|---|
| Boiling Point | 409.3ºC at 760 mmHg |
| Melting Point | 34-38ºC |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.37700 |
| Flash Point | 110ºC |
| Exact Mass | 282.16200 |
| PSA | 26.30000 |
| LogP | 4.94690 |
| Index of Refraction | 1.547 |
| InChIKey | OFNFLSYTTLXGBM-UHFFFAOYSA-N |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(C)cc2)cc1 |
| Storage condition | 2-8℃ |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| p-Pentylphenyl p-methylbenzoate |
| p-Amylphenyl p-toluate,p-Pentylphenyl p-methylbenzoate |
| p-Amylphenyl p-toluate |
| 4-Pentylphenyl p-toluate |
| 4-n-Pentylphenyl-4-methylbenzoate |
| EINECS 256-683-2 |
| 4-Pentylphenyl 4-methylbenzoate |