CHAETOGLOBOSINC structure
|
Common Name | CHAETOGLOBOSINC | ||
|---|---|---|---|---|
| CAS Number | 50645-76-6 | Molecular Weight | 528.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H36N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CHAETOGLOBOSINCChaetoglobosin C (Compound 4) is a anthraquinone-chromone compound derived from the fungus Chaetomium globosum KMITL-N0802. Chaetoglobosin C has anti-tuberculosis activity [1]. |
| Name | (1Z,5Z)-14-((1H-indol-3-yl)methyl)-12-hydroxy-4,6,15,15a-tetramethyl-9,10,14,14a,15,15a,16a,16b-octahydro-3H-cyclotrideca[d]oxireno[2,3-f]isoindole-7,8,11(4H)-trione |
|---|
| Description | Chaetoglobosin C (Compound 4) is a anthraquinone-chromone compound derived from the fungus Chaetomium globosum KMITL-N0802. Chaetoglobosin C has anti-tuberculosis activity [1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C32H36N2O5 |
|---|---|
| Molecular Weight | 528.64 |
| Exact Mass | 528.26200 |
| PSA | 112.12000 |
| LogP | 4.54050 |
| InChIKey | RIZAHVBYKWUPHQ-FSESGWLKSA-N |
| SMILES | CC1=CC(C)CC=CC2C3OC3(C)C(C)C3C(Cc4c[nH]c5ccccc45)NC(=O)C23C(=O)CCC(=O)C1=O |