5-Quinolinesulfonicacid, 8-hydroxy-7-[2-(1-naphthalenyl)diazenyl]-
Modify Date: 2025-09-27 16:52:10
![5-Quinolinesulfonicacid, 8-hydroxy-7-[2-(1-naphthalenyl)diazenyl]- Structure](https://image.chemsrc.com/caspic/185/50539-65-6.png)
5-Quinolinesulfonicacid, 8-hydroxy-7-[2-(1-naphthalenyl)diazenyl]- structure
|
Common Name | 5-Quinolinesulfonicacid, 8-hydroxy-7-[2-(1-naphthalenyl)diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 50539-65-6 | Molecular Weight | 379.38900 | |
| Density | 1.49g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H13N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthylazoxine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Molecular Formula | C19H13N3O4S |
| Molecular Weight | 379.38900 |
| Exact Mass | 379.06300 |
| PSA | 120.59000 |
| LogP | 5.83650 |
| Index of Refraction | 1.724 |
| InChIKey | GTBQEEPPEWJTGD-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(N=Nc2cccc3ccccc23)c(O)c2ncccc12 |
|
~%
5-Quinolinesulf... CAS#:50539-65-6 |
| Literature: Fritz et al. Analytical Chemistry, 1957 , vol. 29, p. 821,822 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Hydroxy-7-[1]naphthylazo-chinolin-5-sulfonsaeure |
| 8-Hydroxy-7-(1-naphthalenylazo)-5-quinolinesulfonic acid |
| 8-Hydroxy-7-(1-naphtylazo)-5-quinolinesulfonic acid |
| 8-Hydroxy-7-(1-naphthylazo)-5-chinolinsulfonsaeure |
| Naphthylazoxine |
| 8-hydroxy-7-(1-naphthalenylazo)-5-quinolinesulfonicaci |
| 7-(Naphthyl-(1)-azo)-8-hydroxy-chinolin-sulfonsaeure-(5) |
| 8-hydroxy-7-[1]naphthylazo-quinoline-5-sulfonic acid |
| 8-hydroxy-7-(1-naphthylazo)quinoline-5-sulphonic acid |