4-Benzyloxy-3-chloronitrobenzene structure
|
Common Name | 4-Benzyloxy-3-chloronitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 50508-54-8 | Molecular Weight | 263.67600 | |
| Density | 1.332g/cm3 | Boiling Point | 403.2ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO3 | Melting Point | 115-119ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 197.6ºC | |
| Name | 2-chloro-4-nitro-1-phenylmethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.332g/cm3 |
|---|---|
| Boiling Point | 403.2ºC at 760 mmHg |
| Melting Point | 115-119ºC(lit.) |
| Molecular Formula | C13H10ClNO3 |
| Molecular Weight | 263.67600 |
| Flash Point | 197.6ºC |
| Exact Mass | 263.03500 |
| PSA | 55.05000 |
| LogP | 4.35040 |
| Index of Refraction | 1.612 |
| InChIKey | KCGQYXJMQHAREQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccccc2)c(Cl)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909309090 |
|
~61%
4-Benzyloxy-3-c... CAS#:50508-54-8 |
| Literature: BAYER PHARMACEUTICALS CORPORATION; ZHANG, Chengzhi Patent: WO2006/23843 A2, 2006 ; Location in patent: Page/Page column 77 ; |
|
~95%
4-Benzyloxy-3-c... CAS#:50508-54-8 |
| Literature: WYETH Patent: US2006/270668 A1, 2006 ; Location in patent: Page/Page column 16 ; |
|
~88%
4-Benzyloxy-3-c... CAS#:50508-54-8 |
| Literature: Capps, David B.; Dunbar, James; Kesten, Suzanne R.; Shillis, Joan; Werbel, Leslie M.; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 26 p. 4770 - 4778 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Benzyloxy-3-chloro-nitrobenzene |
| 1-benzyloxy-2-chloro-4-nitro-benzene |
| MFCD00179914 |
| HMS547D15 |
| 2-chloro-4-nitro-1-(phenylmethoxy)benzene |
| 3-chloro-4-benzyloxynitrobenzene |