2-(3,4-Dichloro-β-oxophenethyl)benzoic acid
Modify Date: 2025-11-30 13:36:33
2-(3,4-Dichloro-β-oxophenethyl)benzoic acid structure
|
Common Name | 2-(3,4-Dichloro-β-oxophenethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 50439-10-6 | Molecular Weight | 309.14400 | |
| Density | 1.417g/cm3 | Boiling Point | 505.4ºC at 760 mmHg | |
| Molecular Formula | C15H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.5ºC | |
| Name | 2-[2-(3,4-dichlorophenyl)-2-oxoethyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 505.4ºC at 760 mmHg |
| Molecular Formula | C15H10Cl2O3 |
| Molecular Weight | 309.14400 |
| Flash Point | 259.5ºC |
| Exact Mass | 308.00100 |
| PSA | 54.37000 |
| LogP | 4.11700 |
| Index of Refraction | 1.628 |
| InChIKey | YCYHVZWPNDQZAM-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1C(=O)O)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3,4-Dichlordesoxybenzoin-2'-carbonsaeure |
| F 1290 |