2-(3,4-Dimethyl-β-oxophenethyl)benzoic acid
Modify Date: 2025-08-26 15:02:07
2-(3,4-Dimethyl-β-oxophenethyl)benzoic acid structure
|
Common Name | 2-(3,4-Dimethyl-β-oxophenethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 50439-02-6 | Molecular Weight | 268.30700 | |
| Density | 1.183g/cm3 | Boiling Point | 462.6ºC at 760 mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.7ºC | |
| Name | 2-[2-(3,4-dimethylphenyl)-2-oxoethyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 462.6ºC at 760 mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 247.7ºC |
| Exact Mass | 268.11000 |
| PSA | 54.37000 |
| LogP | 3.42700 |
| Index of Refraction | 1.597 |
| InChIKey | ZOOUBGRVRUUFQX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Cc2ccccc2C(=O)O)cc1C |
| HS Code | 2918300090 |
|---|
|
~%
2-(3,4-Dimethyl... CAS#:50439-02-6 |
| Literature: Legrand,L.; Lozach,N. Bulletin de la Societe Chimique de France, 1964 , p. 1787 - 1793 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| F 1272 |
| 3,4-Dimethyldesoxybenzoin-2'-carbonsaeure |