3-amino-1-butyl-4-(3-hydroxyphenyl)-1,8-naphthyridin-2-one structure
|
Common Name | 3-amino-1-butyl-4-(3-hydroxyphenyl)-1,8-naphthyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 501690-38-6 | Molecular Weight | 309.36200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-1-butyl-4-(3-hydroxyphenyl)-1,8-naphthyridin-2-one |
|---|
| Molecular Formula | C18H19N3O2 |
|---|---|
| Molecular Weight | 309.36200 |
| Exact Mass | 309.14800 |
| PSA | 81.14000 |
| LogP | 3.73260 |
| InChIKey | DUUMNJMWRUOLRT-UHFFFAOYSA-N |
| SMILES | CCCCn1c(=O)c(N)c(-c2cccc(O)c2)c2cccnc21 |
|
~96%
3-amino-1-butyl... CAS#:501690-38-6 |
| Literature: Ban, Hitoshi; Muraoka, Masami; Ioriya, Katsuhisa; Ohashi, Naohito Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 1 p. 44 - 48 |
|
~%
3-amino-1-butyl... CAS#:501690-38-6 |
| Literature: Ban, Hitoshi; Muraoka, Masami; Ioriya, Katsuhisa; Ohashi, Naohito Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 1 p. 44 - 48 |