Ethyl 4-(benzyloxy)-5,8-dimethoxy-2-naphthoate structure
|
Common Name | Ethyl 4-(benzyloxy)-5,8-dimethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 500777-04-8 | Molecular Weight | 366.40700 | |
| Density | 1.179g/cm3 | Boiling Point | 532.053ºC at 760 mmHg | |
| Molecular Formula | C22H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.412ºC | |
| Name | Ethyl 4-(benzyloxy)-5,8-dimethoxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 532.053ºC at 760 mmHg |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.40700 |
| Flash Point | 232.412ºC |
| Exact Mass | 366.14700 |
| PSA | 53.99000 |
| LogP | 4.61270 |
| Index of Refraction | 1.591 |
| InChIKey | XCASSKXAVDMPQF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(OCc2ccccc2)c2c(OC)ccc(OC)c2c1 |
|
~93%
Ethyl 4-(benzyl... CAS#:500777-04-8 |
| Literature: Kramer, Carsten S.; Nieger, Martin; Braese, Stefan European Journal of Organic Chemistry, 2014 , vol. 2014, # 10 p. 2150 - 2159 |
|
~%
Ethyl 4-(benzyl... CAS#:500777-04-8 |
| Literature: Couladouros, Elias A.; Strongilos, Alexandros T. European Journal of Organic Chemistry, 2002 , # 19 p. 3341 - 3350 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| ethyl 4-benzyloxy-5,8-dimethoxy-2-naphthoate |
| 4-benzyloxyacetoacetic ethyl ester |
| 4-benzyloxy-3-oxo-butyric acid ethyl ester |
| ethyl 4-benzyloxyacetoacetate |
| ethyl 4-benzyloxy-3-oxobutyrate |