Ethyl 4-acetoxy-5,8-dimethoxy-2-naphthoate structure
|
Common Name | Ethyl 4-acetoxy-5,8-dimethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 25932-95-0 | Molecular Weight | 318.32100 | |
| Density | 1.207g/cm3 | Boiling Point | 477ºC at 760 mmHg | |
| Molecular Formula | C17H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.2ºC | |
| Name | Ethyl 4-acetoxy-5,8-dimethoxy-2-naphthoate |
|---|
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 477ºC at 760 mmHg |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.32100 |
| Flash Point | 211.2ºC |
| Exact Mass | 318.11000 |
| PSA | 71.06000 |
| LogP | 2.95900 |
| Vapour Pressure | 2.91E-09mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | PTDZJPKRIGERKK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2c(OC)ccc(OC)c2c1 |
|
~%
Ethyl 4-acetoxy... CAS#:25932-95-0 |
|
Literature: Harper,S.H. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , vol. |
| Precursor 3 | |
|---|---|
| DownStream 7 | |