3-(3,4-dichlorophenyl)-1-propyl-urea structure
|
Common Name | 3-(3,4-dichlorophenyl)-1-propyl-urea | ||
|---|---|---|---|---|
| CAS Number | 5006-83-7 | Molecular Weight | 247.12100 | |
| Density | 1.312g/cm3 | Boiling Point | 325.6ºC at 760 mmHg | |
| Molecular Formula | C10H12Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.7ºC | |
| Name | 1-(3,4-dichlorophenyl)-3-propylurea |
|---|
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 325.6ºC at 760 mmHg |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12100 |
| Flash Point | 150.7ºC |
| Exact Mass | 246.03300 |
| PSA | 41.13000 |
| LogP | 3.98880 |
| Index of Refraction | 1.585 |
| InChIKey | KIQHGAXOSYPDMA-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |