3-amino-3-(4-methoxynaphthalen-1-yl)propanoic acid
Modify Date: 2025-08-28 22:06:02
3-amino-3-(4-methoxynaphthalen-1-yl)propanoic acid structure
|
Common Name | 3-amino-3-(4-methoxynaphthalen-1-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 499987-13-2 | Molecular Weight | 245.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-3-(4-methoxynaphthalen-1-yl)propanoic acid |
|---|
| Molecular Formula | C14H15NO3 |
|---|---|
| Molecular Weight | 245.27400 |
| Exact Mass | 245.10500 |
| PSA | 72.55000 |
| LogP | 3.02320 |
| InChIKey | OPRZIKIUFPFNQS-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(N)CC(=O)O)c2ccccc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |