B,B-TREHALOSE
Modify Date: 2025-09-11 09:41:20
B,B-TREHALOSE structure
|
Common Name | B,B-TREHALOSE | ||
|---|---|---|---|---|
| CAS Number | 499-23-0 | Molecular Weight | 342.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of B,B-TREHALOSEβ,β-Trehalose is a analog of trehalose. β,β-Trehalose can support the growth of shoot tips of Cuscuta. β,β-Trehalose can be cleaved by nonspecific β-glucosidase[1]. |
| Name | β-D-Glucopyranosyl β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | β,β-Trehalose is a analog of trehalose. β,β-Trehalose can support the growth of shoot tips of Cuscuta. β,β-Trehalose can be cleaved by nonspecific β-glucosidase[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H22O11 |
|---|---|
| Molecular Weight | 342.30 |
| Exact Mass | 342.11600 |
| PSA | 189.53000 |
| InChIKey | HDTRYLNUVZCQOY-NCFXGAEVSA-N |
| SMILES | OCC1OC(OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| Propionyl chloride,3,3'-thiodi |
| 3,3'-thiodipropionic acid dichloride |
| 3,3'-thiopropionyl chloride |
| 3,3'-Thiobispropanoyl chloride |
| Propanoyl chloride,3,3'-thiobis |
| 3,3'-thiodipropanoylchloride |
| 3,3'-Thiodipropionyl dichloride |
| 3,3'-Thiodipropionyl chloride |
| 3,3'-Thiodipropionic acid chloride |
| 2-Carboxyethylthiopropionyl chloride |