5-[(4-nitrobenzoyl)amino]pentanoic acid
Modify Date: 2025-10-04 19:36:35
![5-[(4-nitrobenzoyl)amino]pentanoic acid Structure](https://image.chemsrc.com/caspic/002/4986-87-2.png)
5-[(4-nitrobenzoyl)amino]pentanoic acid structure
|
Common Name | 5-[(4-nitrobenzoyl)amino]pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4986-87-2 | Molecular Weight | 266.25000 | |
| Density | 1.316g/cm3 | Boiling Point | 543.7ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.6ºC | |
| Name | 5-[(4-nitrobenzoyl)amino]pentanoic acid |
|---|
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 543.7ºC at 760 mmHg |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25000 |
| Flash Point | 282.6ºC |
| Exact Mass | 266.09000 |
| PSA | 112.22000 |
| LogP | 2.49360 |
| Index of Refraction | 1.571 |
| InChIKey | JYXHOGZHGJXNRA-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCNC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
5-[(4-nitrobenz... CAS#:4986-87-2 |
| Literature: Archer et al. Journal of the American Pharmaceutical Association (1912-1977), 1951 , vol. 40, p. 143,144, 149 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |