Methanone,(4-nitrophenyl)-1-piperidinyl- structure
|
Common Name | Methanone,(4-nitrophenyl)-1-piperidinyl- | ||
|---|---|---|---|---|
| CAS Number | 20857-92-5 | Molecular Weight | 234.25100 | |
| Density | 1.256g/cm3 | Boiling Point | 419.5ºC at 760mmHg | |
| Molecular Formula | C12H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
| Name | (4-nitrophenyl)-piperidin-1-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 419.5ºC at 760mmHg |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25100 |
| Flash Point | 207.5ºC |
| Exact Mass | 234.10000 |
| PSA | 66.13000 |
| LogP | 2.68200 |
| Vapour Pressure | 3.03E-07mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | CAKBAYWOHIUVHR-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-nitrophenyl-1-piperidinylmethanone |
| 1-(4-nitrobenzoyl)piperidine |
| (4-nitrophenyl)-N-(piperidin-1-yl)methanone |
| (4-nitrophenyl)( piperidin-1-yl)methanone |
| N-p-nitrobenzoylpiperidine |
| 4-nitrophenyl piperidyl ketone |
| 1-(p-Nitrobenzoyl)piperidine |