4-Cyanophenyl 4-pentylbenzoate
Modify Date: 2025-08-25 05:37:31
4-Cyanophenyl 4-pentylbenzoate structure
|
Common Name | 4-Cyanophenyl 4-pentylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 49763-64-6 | Molecular Weight | 293.36000 | |
| Density | 1.12 g/cm3 | Boiling Point | 453.3ºC at 760 mmHg | |
| Molecular Formula | C19H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.3ºC | |
| Name | (4-cyanophenyl) 4-pentylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12 g/cm3 |
|---|---|
| Boiling Point | 453.3ºC at 760 mmHg |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.36000 |
| Flash Point | 225.3ºC |
| Exact Mass | 293.14200 |
| PSA | 50.09000 |
| LogP | 4.51018 |
| Index of Refraction | 1.57 |
| InChIKey | WCCDNUMASFDPFO-UHFFFAOYSA-N |
| SMILES | CCCCCc1ccc(C(=O)Oc2ccc(C#N)cc2)cc1 |
| HS Code | 2926909090 |
|---|
|
~%
4-Cyanophenyl 4... CAS#:49763-64-6 |
| Literature: Gray, G. W.; Hird, M.; Lacey, D.; Toyne, K. J. Molecular Crystals and Liquid Crystals (1969-1991), 1989 , vol. 172, p. 165 - 190 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-cyanophenyl 4-pentylbenzoate |
| p-cyanophenyl p-pentylbenzoate |
| p-n-pentylbenzoic acid p'-cyanophenyl ester |
| 4-cyanopheny 4-pentylbenzoate |
| p'-cyanophenyl-p-n-pentylbenzoate |
| EINECS 256-477-2 |