6,7-bis(2-phenylethyl)pteridine-2,4-diamine
Modify Date: 2025-08-26 21:47:12
6,7-bis(2-phenylethyl)pteridine-2,4-diamine structure
|
Common Name | 6,7-bis(2-phenylethyl)pteridine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 49647-27-0 | Molecular Weight | 370.45000 | |
| Density | 1.286g/cm3 | Boiling Point | 564.1ºC at 760 mmHg | |
| Molecular Formula | C22H22N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.5ºC | |
| Name | 6,7-bis(2-phenylethyl)pteridine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 564.1ºC at 760 mmHg |
| Molecular Formula | C22H22N6 |
| Molecular Weight | 370.45000 |
| Flash Point | 329.5ºC |
| Exact Mass | 370.19100 |
| PSA | 104.33000 |
| LogP | 3.66590 |
| Index of Refraction | 1.713 |
| InChIKey | AIJPQVCGALXUBW-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2nc(CCc3ccccc3)c(CCc3ccccc3)nc2n1 |
|
~%
6,7-bis(2-pheny... CAS#:49647-27-0 |
| Literature: Nelson; Rosowsky Antimicrobial Agents and Chemotherapy, 2001 , vol. 45, # 12 p. 3293 - 3303 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| PT331 |
| 6,7-diphenethylpteridine-2,4-diamine |